C21H21FN4O3S — CID 156875752
2-amino-1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-2-(2-fluorocyclohexa-1,5-dien-1-yl)ethanone (PubChem CID 156875752) has the molecular formula C21H21FN4O3S and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-amino-1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-2-(2-fluorocyclohexa-1,5-dien-1-yl)ethanone.
| Compound Name | 2-amino-1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-2-(2-fluorocyclohexa-1,5-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 156875752 |
| Molecular Formula | C21H21FN4O3S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-amino-1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-2-(2-fluorocyclohexa-1,5-dien-1-yl)ethanone |
| SMILES | NC(C(=O)N1Cc2cn(Sc3ccc4c(c3)OCCO4)nc2C1)C1=C(F)CCC=C1 |
| InChI | InChI=1S/C21H21FN4O3S/c22-16-4-2-1-3-15(16)20(23)21(27)25-10-13-11-26(24-17(13)12-25)30-14-5-6-18-19(9-14)29-8-7-28-18/h1,3,5-6,9,11,20H,2,4,7-8,10,12,23H2 |
| InChIKey | ULAOGBIZYYUQJY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |