About 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one
8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one (PubChem CID 156876366) has the molecular formula C16H18BrNO3
and a molecular weight of 352.23 g/mol. Its IUPAC name is 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one.
Molecular Properties
| Compound Name | 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one |
| PubChem CID | 156876366 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one |
| SMILES | Cc1cc(Br)c2oc(N3C[C@@H](C)O[C@@H](C)C3)cc(=O)c2c1 |
| InChI | InChI=1S/C16H18BrNO3/c1-9-4-12-14(19)6-15(21-16(12)13(17)5-9)18-7-10(2)20-11(3)8-18/h4-6,10-11H,7-8H2,1-3H3/t10-,11+ |
| InChIKey | VKJRJSKTKFBZDM-PHIMTYICSA-N |
| XLogP | 3.48 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one?
The IUPAC name of 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one (CID 156876366) is 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one.
What is the SMILES notation for 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one?
The canonical SMILES for 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one is Cc1cc(Br)c2oc(N3C[C@@H](C)O[C@@H](C)C3)cc(=O)c2c1.
What is the InChIKey of 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one?
The InChIKey is VKJRJSKTKFBZDM-PHIMTYICSA-N. The full InChI is InChI=1S/C16H18BrNO3/c1-9-4-12-14(19)6-15(21-16(12)13(17)5-9)18-7-10(2)20-11(3)8-18/h4-6,10-11H,7-8H2,1-3H3/t10-,11+.
What are the key properties of 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one?
8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one has a molecular weight of 352.23 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylchromen-4-one is sourced from PubChem (CID 156876366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).