About 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid
2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid (PubChem CID 156876434) has the molecular formula C27H23FN2O4
and a molecular weight of 458.49 g/mol. Its IUPAC name is 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid.
Molecular Properties
| Compound Name | 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid |
| PubChem CID | 156876434 |
| Molecular Formula | C27H23FN2O4 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid |
| SMILES | Cc1cc(C(C)Nc2ccccc2C(=O)O)c2oc(N3Cc4ccc(F)cc4C3)cc(=O)c2c1 |
| InChI | InChI=1S/C27H23FN2O4/c1-15-9-21(16(2)29-23-6-4-3-5-20(23)27(32)33)26-22(10-15)24(31)12-25(34-26)30-13-17-7-8-19(28)11-18(17)14-30/h3-12,16,29H,13-14H2,1-2H3,(H,32,33) |
| InChIKey | JTEDMQKUEQXTQL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid?
The IUPAC name of 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid (CID 156876434) is 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid.
What is the SMILES notation for 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid?
The canonical SMILES for 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid is Cc1cc(C(C)Nc2ccccc2C(=O)O)c2oc(N3Cc4ccc(F)cc4C3)cc(=O)c2c1.
What is the InChIKey of 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid?
The InChIKey is JTEDMQKUEQXTQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23FN2O4/c1-15-9-21(16(2)29-23-6-4-3-5-20(23)27(32)33)26-22(10-15)24(31)12-25(34-26)30-13-17-7-8-19(28)11-18(17)14-30/h3-12,16,29H,13-14H2,1-2H3,(H,32,33).
What are the key properties of 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid?
2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid has a molecular weight of 458.49 g/mol, XLogP of 5.63, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid is sourced from PubChem (CID 156876434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).