About 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine
6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine (PubChem CID 156876979) has the molecular formula C10H6F2N4
and a molecular weight of 220.18 g/mol. Its IUPAC name is 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine.
Molecular Properties
| Compound Name | 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine |
| PubChem CID | 156876979 |
| Molecular Formula | C10H6F2N4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine |
| SMILES | Nc1ncnc2[nH]c3cc(F)c(F)cc3c12 |
| InChI | InChI=1S/C10H6F2N4/c11-5-1-4-7(2-6(5)12)16-10-8(4)9(13)14-3-15-10/h1-3H,(H3,13,14,15,16) |
| InChIKey | NHHASAULXBPYMV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine?
The IUPAC name of 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine (CID 156876979) is 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine.
What is the SMILES notation for 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine?
The canonical SMILES for 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine is Nc1ncnc2[nH]c3cc(F)c(F)cc3c12.
What is the InChIKey of 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine?
The InChIKey is NHHASAULXBPYMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2N4/c11-5-1-4-7(2-6(5)12)16-10-8(4)9(13)14-3-15-10/h1-3H,(H3,13,14,15,16).
What are the key properties of 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine?
6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine has a molecular weight of 220.18 g/mol, XLogP of 1.97, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-difluoro-9H-pyrimido[4,5-b]indol-4-amine is sourced from PubChem (CID 156876979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).