C21H21F2NO3 — CID 156877155
3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]propanoic acid (PubChem CID 156877155) has the molecular formula C21H21F2NO3 and a molecular weight of 373.40 g/mol. Its IUPAC name is 3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]propanoic acid.
| Compound Name | 3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 156877155 |
| Molecular Formula | C21H21F2NO3 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]propanoic acid |
| SMILES | Cc1cc(-n2c(C(C)C)c(CCC(=O)O)c3cc(O)c(F)cc32)ccc1F |
| InChI | InChI=1S/C21H21F2NO3/c1-11(2)21-14(5-7-20(26)27)15-9-19(25)17(23)10-18(15)24(21)13-4-6-16(22)12(3)8-13/h4,6,8-11,25H,5,7H2,1-3H3,(H,26,27) |
| InChIKey | QLVKKTQLCRVBIL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |