About 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid
3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid (PubChem CID 156877257) has the molecular formula C22H21F2NO3
and a molecular weight of 385.41 g/mol. Its IUPAC name is 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid |
| PubChem CID | 156877257 |
| Molecular Formula | C22H21F2NO3 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid |
| SMILES | CC(C)c1c(C2CC(C(=O)O)C2)c2cc(O)ccc2n1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H21F2NO3/c1-11(2)21-20(12-7-13(8-12)22(27)28)16-10-15(26)4-6-19(16)25(21)14-3-5-17(23)18(24)9-14/h3-6,9-13,26H,7-8H2,1-2H3,(H,27,28) |
| InChIKey | SAHJXGVNNFKQKW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid?
The IUPAC name of 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid (CID 156877257) is 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid?
The canonical SMILES for 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid is CC(C)c1c(C2CC(C(=O)O)C2)c2cc(O)ccc2n1-c1ccc(F)c(F)c1.
What is the InChIKey of 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid?
The InChIKey is SAHJXGVNNFKQKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F2NO3/c1-11(2)21-20(12-7-13(8-12)22(27)28)16-10-15(26)4-6-19(16)25(21)14-3-5-17(23)18(24)9-14/h3-6,9-13,26H,7-8H2,1-2H3,(H,27,28).
What are the key properties of 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid?
3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid has a molecular weight of 385.41 g/mol, XLogP of 5.32, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3,4-difluorophenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 156877257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).