C20H37NO2S — CID 156877679
ethane;2-methylpropane;1-(4-propan-2-ylphenyl)sulfinylpiperidin-3-ol (PubChem CID 156877679) has the molecular formula C20H37NO2S and a molecular weight of 355.59 g/mol. Its IUPAC name is ethane;2-methylpropane;1-(4-propan-2-ylphenyl)sulfinylpiperidin-3-ol.
| Compound Name | ethane;2-methylpropane;1-(4-propan-2-ylphenyl)sulfinylpiperidin-3-ol |
|---|---|
| PubChem CID | 156877679 |
| Molecular Formula | C20H37NO2S |
| Molecular Weight | 355.59 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | ethane;2-methylpropane;1-(4-propan-2-ylphenyl)sulfinylpiperidin-3-ol |
| SMILES | CC.CC(C)C.CC(C)c1ccc(S(=O)N2CCCC(O)C2)cc1 |
| InChI | InChI=1S/C14H21NO2S.C4H10.C2H6/c1-11(2)12-5-7-14(8-6-12)18(17)15-9-3-4-13(16)10-15;1-4(2)3;1-2/h5-8,11,13,16H,3-4,9-10H2,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | QYENZHCBIAMBHC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |