C18H32O3 — CID 156877716
(1E,3E,4E)-3-ethylidene-5,6-dimethoxy-2-propan-2-ylhepta-1,4,6-trien-1-ol;2-methylpropane (PubChem CID 156877716) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is (1E,3E,4E)-3-ethylidene-5,6-dimethoxy-2-propan-2-ylhepta-1,4,6-trien-1-ol;2-methylpropane.
| Compound Name | (1E,3E,4E)-3-ethylidene-5,6-dimethoxy-2-propan-2-ylhepta-1,4,6-trien-1-ol;2-methylpropane |
|---|---|
| PubChem CID | 156877716 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | (1E,3E,4E)-3-ethylidene-5,6-dimethoxy-2-propan-2-ylhepta-1,4,6-trien-1-ol;2-methylpropane |
| SMILES | C=C(OC)/C(=C\C(=C/C)\C(=C\O)C(C)C)OC.CC(C)C |
| InChI | InChI=1S/C14H22O3.C4H10/c1-7-12(13(9-15)10(2)3)8-14(17-6)11(4)16-5;1-4(2)3/h7-10,15H,4H2,1-3,5-6H3;4H,1-3H3/b12-7+,13-9+,14-8+; |
| InChIKey | NDCSWRKPQKMHDU-GPANOJLKSA-N |
| XLogP | 5.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|