C15H25NOS — CID 156877731
1-[(3E,5E)-6,7-dimethylocta-1,3,5-trien-3-yl]sulfinylpiperidine (PubChem CID 156877731) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is 1-[(3E,5E)-6,7-dimethylocta-1,3,5-trien-3-yl]sulfinylpiperidine.
| Compound Name | 1-[(3E,5E)-6,7-dimethylocta-1,3,5-trien-3-yl]sulfinylpiperidine |
|---|---|
| PubChem CID | 156877731 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-[(3E,5E)-6,7-dimethylocta-1,3,5-trien-3-yl]sulfinylpiperidine |
| SMILES | C=C/C(=C\C=C(/C)C(C)C)S(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H25NOS/c1-5-15(10-9-14(4)13(2)3)18(17)16-11-7-6-8-12-16/h5,9-10,13H,1,6-8,11-12H2,2-4H3/b14-9+,15-10+ |
| InChIKey | QEUWZSGDBQFIAX-AOEKMSOUSA-N |
| XLogP | 3.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|