C19H32N2OS — CID 156877770
1-[(3E,5E)-6,7-dimethylocta-1,3,5-trien-3-yl]sulfinyl-4-pyrrolidin-1-ylpiperidine (PubChem CID 156877770) has the molecular formula C19H32N2OS and a molecular weight of 336.55 g/mol. Its IUPAC name is 1-[(3E,5E)-6,7-dimethylocta-1,3,5-trien-3-yl]sulfinyl-4-pyrrolidin-1-ylpiperidine.
| Compound Name | 1-[(3E,5E)-6,7-dimethylocta-1,3,5-trien-3-yl]sulfinyl-4-pyrrolidin-1-ylpiperidine |
|---|---|
| PubChem CID | 156877770 |
| Molecular Formula | C19H32N2OS |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-[(3E,5E)-6,7-dimethylocta-1,3,5-trien-3-yl]sulfinyl-4-pyrrolidin-1-ylpiperidine |
| SMILES | C=C/C(=C\C=C(/C)C(C)C)S(=O)N1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C19H32N2OS/c1-5-19(9-8-17(4)16(2)3)23(22)21-14-10-18(11-15-21)20-12-6-7-13-20/h5,8-9,16,18H,1,6-7,10-15H2,2-4H3/b17-8+,19-9+ |
| InChIKey | JEVMEGOHQZHDBS-RRGFOBCVSA-N |
| XLogP | 3.88 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|