C18H32N2OS — CID 156877836
N,N-dimethyl-1-[(3E,5Z)-6-propan-2-ylocta-3,5,7-trien-3-yl]sulfinylpiperidin-4-amine (PubChem CID 156877836) has the molecular formula C18H32N2OS and a molecular weight of 324.53 g/mol. Its IUPAC name is N,N-dimethyl-1-[(3E,5Z)-6-propan-2-ylocta-3,5,7-trien-3-yl]sulfinylpiperidin-4-amine.
| Compound Name | N,N-dimethyl-1-[(3E,5Z)-6-propan-2-ylocta-3,5,7-trien-3-yl]sulfinylpiperidin-4-amine |
|---|---|
| PubChem CID | 156877836 |
| Molecular Formula | C18H32N2OS |
| Molecular Weight | 324.53 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | N,N-dimethyl-1-[(3E,5Z)-6-propan-2-ylocta-3,5,7-trien-3-yl]sulfinylpiperidin-4-amine |
| SMILES | C=C/C(=C\C=C(/CC)S(=O)N1CCC(N(C)C)CC1)C(C)C |
| InChI | InChI=1S/C18H32N2OS/c1-7-16(15(3)4)9-10-18(8-2)22(21)20-13-11-17(12-14-20)19(5)6/h7,9-10,15,17H,1,8,11-14H2,2-6H3/b16-9+,18-10+ |
| InChIKey | JKOBUAQFKUKKCT-FRCVOOFRSA-N |
| XLogP | 3.74 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|