C17H26N2O — CID 156877867
(2E,4Z)-2-ethenyl-1-(4-methylpiperazin-1-yl)-5-propan-2-ylhepta-2,4,6-trien-1-one (PubChem CID 156877867) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-1-(4-methylpiperazin-1-yl)-5-propan-2-ylhepta-2,4,6-trien-1-one.
| Compound Name | (2E,4Z)-2-ethenyl-1-(4-methylpiperazin-1-yl)-5-propan-2-ylhepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 156877867 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (2E,4Z)-2-ethenyl-1-(4-methylpiperazin-1-yl)-5-propan-2-ylhepta-2,4,6-trien-1-one |
| SMILES | C=C/C(=C\C=C(/C=C)C(=O)N1CCN(C)CC1)C(C)C |
| InChI | InChI=1S/C17H26N2O/c1-6-15(14(3)4)8-9-16(7-2)17(20)19-12-10-18(5)11-13-19/h6-9,14H,1-2,10-13H2,3-5H3/b15-8+,16-9+ |
| InChIKey | GXQUMCRIKYRPBT-BVXMOGEKSA-N |
| XLogP | 2.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|