C19H34N2OS — CID 156877904
1-(2-methylpropyl)-4-[(2E,4Z,6Z)-6-propan-2-ylocta-2,4,6-trien-3-yl]sulfinylpiperazine (PubChem CID 156877904) has the molecular formula C19H34N2OS and a molecular weight of 338.56 g/mol. Its IUPAC name is 1-(2-methylpropyl)-4-[(2E,4Z,6Z)-6-propan-2-ylocta-2,4,6-trien-3-yl]sulfinylpiperazine.
| Compound Name | 1-(2-methylpropyl)-4-[(2E,4Z,6Z)-6-propan-2-ylocta-2,4,6-trien-3-yl]sulfinylpiperazine |
|---|---|
| PubChem CID | 156877904 |
| Molecular Formula | C19H34N2OS |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 1-(2-methylpropyl)-4-[(2E,4Z,6Z)-6-propan-2-ylocta-2,4,6-trien-3-yl]sulfinylpiperazine |
| SMILES | C/C=C(\C=C/C(=C\C)S(=O)N1CCN(CC(C)C)CC1)C(C)C |
| InChI | InChI=1S/C19H34N2OS/c1-7-18(17(5)6)9-10-19(8-2)23(22)21-13-11-20(12-14-21)15-16(3)4/h7-10,16-17H,11-15H2,1-6H3/b10-9-,18-7+,19-8+ |
| InChIKey | CDYLZSHFCSSCMT-OMSGRQHASA-N |
| XLogP | 3.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|