C24H46N2OS — CID 156877957
N,N-diethyl-1-[(3E,5Z)-6-propan-2-ylocta-1,3,5,7-tetraen-3-yl]sulfinylpiperidin-4-amine;ethane (PubChem CID 156877957) has the molecular formula C24H46N2OS and a molecular weight of 410.71 g/mol. Its IUPAC name is N,N-diethyl-1-[(3E,5Z)-6-propan-2-ylocta-1,3,5,7-tetraen-3-yl]sulfinylpiperidin-4-amine;ethane.
| Compound Name | N,N-diethyl-1-[(3E,5Z)-6-propan-2-ylocta-1,3,5,7-tetraen-3-yl]sulfinylpiperidin-4-amine;ethane |
|---|---|
| PubChem CID | 156877957 |
| Molecular Formula | C24H46N2OS |
| Molecular Weight | 410.71 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | N,N-diethyl-1-[(3E,5Z)-6-propan-2-ylocta-1,3,5,7-tetraen-3-yl]sulfinylpiperidin-4-amine;ethane |
| SMILES | C=C/C(=C\C=C(/C=C)S(=O)N1CCC(N(CC)CC)CC1)C(C)C.CC.CC |
| InChI | InChI=1S/C20H34N2OS.2C2H6/c1-7-18(17(5)6)11-12-20(8-2)24(23)22-15-13-19(14-16-22)21(9-3)10-4;2*1-2/h7-8,11-12,17,19H,1-2,9-10,13-16H2,3-6H3;2*1-2H3/b18-11+,20-12+;; |
| InChIKey | XVHCLQYRIQGKNT-KRGNHQLVSA-N |
| XLogP | 6.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|