C22H41NO2 — CID 156877979
ethane;(2E,4Z)-1-(3-hydroxypiperidin-1-yl)-2-methyl-5-propan-2-ylhepta-2,4,6-trien-1-one;2-methylpropane (PubChem CID 156877979) has the molecular formula C22H41NO2 and a molecular weight of 351.58 g/mol. Its IUPAC name is ethane;(2E,4Z)-1-(3-hydroxypiperidin-1-yl)-2-methyl-5-propan-2-ylhepta-2,4,6-trien-1-one;2-methylpropane.
| Compound Name | ethane;(2E,4Z)-1-(3-hydroxypiperidin-1-yl)-2-methyl-5-propan-2-ylhepta-2,4,6-trien-1-one;2-methylpropane |
|---|---|
| PubChem CID | 156877979 |
| Molecular Formula | C22H41NO2 |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.31 |
| IUPAC Name | ethane;(2E,4Z)-1-(3-hydroxypiperidin-1-yl)-2-methyl-5-propan-2-ylhepta-2,4,6-trien-1-one;2-methylpropane |
| SMILES | C=C/C(=C\C=C(/C)C(=O)N1CCCC(O)C1)C(C)C.CC.CC(C)C |
| InChI | InChI=1S/C16H25NO2.C4H10.C2H6/c1-5-14(12(2)3)9-8-13(4)16(19)17-10-6-7-15(18)11-17;1-4(2)3;1-2/h5,8-9,12,15,18H,1,6-7,10-11H2,2-4H3;4H,1-3H3;1-2H3/b13-8+,14-9+;; |
| InChIKey | DHLQUBPXGUKXJH-OTLJHXNCSA-N |
| XLogP | 5.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|