C17H27NO2 — CID 156878215
(3Z,5Z)-5-ethyl-1-[4-(2-hydroxyethyl)piperidin-1-yl]-2-methylidenehepta-3,5-dien-1-one (PubChem CID 156878215) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (3Z,5Z)-5-ethyl-1-[4-(2-hydroxyethyl)piperidin-1-yl]-2-methylidenehepta-3,5-dien-1-one.
| Compound Name | (3Z,5Z)-5-ethyl-1-[4-(2-hydroxyethyl)piperidin-1-yl]-2-methylidenehepta-3,5-dien-1-one |
|---|---|
| PubChem CID | 156878215 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (3Z,5Z)-5-ethyl-1-[4-(2-hydroxyethyl)piperidin-1-yl]-2-methylidenehepta-3,5-dien-1-one |
| SMILES | C=C(/C=C\C(=C/C)CC)C(=O)N1CCC(CCO)CC1 |
| InChI | InChI=1S/C17H27NO2/c1-4-15(5-2)7-6-14(3)17(20)18-11-8-16(9-12-18)10-13-19/h4,6-7,16,19H,3,5,8-13H2,1-2H3/b7-6-,15-4- |
| InChIKey | PLRXEKFHOAEXSZ-LPFVQNGZSA-N |
| XLogP | 3.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|