About (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one
(2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one (PubChem CID 15687833) has the molecular formula C16H22O2S
and a molecular weight of 278.42 g/mol. Its IUPAC name is (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one |
| PubChem CID | 15687833 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one |
| SMILES | CO[C@@H]([C@H](C)Sc1ccccc1)[C@H]1CCCCC1=O |
| InChI | InChI=1S/C16H22O2S/c1-12(19-13-8-4-3-5-9-13)16(18-2)14-10-6-7-11-15(14)17/h3-5,8-9,12,14,16H,6-7,10-11H2,1-2H3/t12-,14-,16-/m0/s1 |
| InChIKey | SQWFEGCCUPCPQB-NOLJZWGESA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one?
The IUPAC name of (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one (CID 15687833) is (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one.
What is the SMILES notation for (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one?
The canonical SMILES for (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one is CO[C@@H]([C@H](C)Sc1ccccc1)[C@H]1CCCCC1=O.
What is the InChIKey of (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one?
The InChIKey is SQWFEGCCUPCPQB-NOLJZWGESA-N. The full InChI is InChI=1S/C16H22O2S/c1-12(19-13-8-4-3-5-9-13)16(18-2)14-10-6-7-11-15(14)17/h3-5,8-9,12,14,16H,6-7,10-11H2,1-2H3/t12-,14-,16-/m0/s1.
What are the key properties of (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one?
(2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one has a molecular weight of 278.42 g/mol, XLogP of 3.94, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1R,2S)-1-methoxy-2-phenylsulfanylpropyl]cyclohexan-1-one is sourced from PubChem (CID 15687833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).