C27H24FNO4 — CID 156878666
2-[3-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]phenyl]acetic acid (PubChem CID 156878666) has the molecular formula C27H24FNO4 and a molecular weight of 445.49 g/mol. Its IUPAC name is 2-[3-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 156878666 |
| Molecular Formula | C27H24FNO4 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2-[3-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(-c2c(C3CCOCC3)n(-c3ccc(F)cc3)c3cccc(O)c23)c1 |
| InChI | InChI=1S/C27H24FNO4/c28-20-7-9-21(10-8-20)29-22-5-2-6-23(30)26(22)25(27(29)18-11-13-33-14-12-18)19-4-1-3-17(15-19)16-24(31)32/h1-10,15,18,30H,11-14,16H2,(H,31,32) |
| InChIKey | OEINCNUOZAVRDA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |