C35H32F3NO10 — CID 156878746
prop-2-enyl (2S,3S,4S,5R)-6-[4-[1-(3,4-difluorophenyl)-6-fluoro-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 156878746) has the molecular formula C35H32F3NO10 and a molecular weight of 683.63 g/mol. Its IUPAC name is prop-2-enyl (2S,3S,4S,5R)-6-[4-[1-(3,4-difluorophenyl)-6-fluoro-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | prop-2-enyl (2S,3S,4S,5R)-6-[4-[1-(3,4-difluorophenyl)-6-fluoro-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 156878746 |
| Molecular Formula | C35H32F3NO10 |
| Molecular Weight | 683.63 g/mol |
| Exact Mass | 683.20 |
| IUPAC Name | prop-2-enyl (2S,3S,4S,5R)-6-[4-[1-(3,4-difluorophenyl)-6-fluoro-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1OC(OC(=O)c2ccc(-c3c(C4CCOCC4)n(-c4ccc(F)c(F)c4)c4cc(F)cc(O)c34)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H32F3NO10/c1-2-11-47-34(45)32-30(42)29(41)31(43)35(48-32)49-33(44)19-5-3-17(4-6-19)26-27-24(14-20(36)15-25(27)40)39(21-7-8-22(37)23(38)16-21)28(26)18-9-12-46-13-10-18/h2-8,14-16,18,29-32,35,40-43H,1,9-13H2/t29-,30-,31+,32-,35?/m0/s1 |
| InChIKey | VZZWMURWIXQTMJ-KHGAUMIWSA-N |
| XLogP | 4.01 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|