C24H23FN4O2 — CID 156878859
1-(4-fluorophenyl)-3-[2-(methylamino)pyrimidin-5-yl]-2-(oxan-4-yl)indol-4-ol (PubChem CID 156878859) has the molecular formula C24H23FN4O2 and a molecular weight of 418.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[2-(methylamino)pyrimidin-5-yl]-2-(oxan-4-yl)indol-4-ol.
| Compound Name | 1-(4-fluorophenyl)-3-[2-(methylamino)pyrimidin-5-yl]-2-(oxan-4-yl)indol-4-ol |
|---|---|
| PubChem CID | 156878859 |
| Molecular Formula | C24H23FN4O2 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[2-(methylamino)pyrimidin-5-yl]-2-(oxan-4-yl)indol-4-ol |
| SMILES | CNc1ncc(-c2c(C3CCOCC3)n(-c3ccc(F)cc3)c3cccc(O)c23)cn1 |
| InChI | InChI=1S/C24H23FN4O2/c1-26-24-27-13-16(14-28-24)21-22-19(3-2-4-20(22)30)29(18-7-5-17(25)6-8-18)23(21)15-9-11-31-12-10-15/h2-8,13-15,30H,9-12H2,1H3,(H,26,27,28) |
| InChIKey | YVCRCNWYHOBYME-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |