C26H26FNO4 — CID 156878934
4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 156878934) has the molecular formula C26H26FNO4 and a molecular weight of 435.50 g/mol. Its IUPAC name is 4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 156878934 |
| Molecular Formula | C26H26FNO4 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=C(c2c(C3CCOCC3)n(-c3ccc(F)cc3)c3cccc(O)c23)CC1 |
| InChI | InChI=1S/C26H26FNO4/c27-19-8-10-20(11-9-19)28-21-2-1-3-22(29)24(21)23(25(28)17-12-14-32-15-13-17)16-4-6-18(7-5-16)26(30)31/h1-4,8-11,17-18,29H,5-7,12-15H2,(H,30,31) |
| InChIKey | XJZFCSJHFOIHPV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |