C32H28F3NO10 — CID 156878939
(2S,3S,4S,5R)-6-[4-[1-(3,4-difluorophenyl)-6-fluoro-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 156878939) has the molecular formula C32H28F3NO10 and a molecular weight of 643.57 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[4-[1-(3,4-difluorophenyl)-6-fluoro-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-6-[4-[1-(3,4-difluorophenyl)-6-fluoro-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 156878939 |
| Molecular Formula | C32H28F3NO10 |
| Molecular Weight | 643.57 g/mol |
| Exact Mass | 643.17 |
| IUPAC Name | (2S,3S,4S,5R)-6-[4-[1-(3,4-difluorophenyl)-6-fluoro-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(OC1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)c1ccc(-c2c(C3CCOCC3)n(-c3ccc(F)c(F)c3)c3cc(F)cc(O)c23)cc1 |
| InChI | InChI=1S/C32H28F3NO10/c33-17-11-21-24(22(37)12-17)23(25(15-7-9-44-10-8-15)36(21)18-5-6-19(34)20(35)13-18)14-1-3-16(4-2-14)31(43)46-32-28(40)26(38)27(39)29(45-32)30(41)42/h1-6,11-13,15,26-29,32,37-40H,7-10H2,(H,41,42)/t26-,27-,28+,29-,32?/m0/s1 |
| InChIKey | NTCYBOLCRQPDHX-UMCYHJSXSA-N |
| XLogP | 3.36 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |