About CID 156879113
CID 156879113 (PubChem CID 156879113) has the molecular formula C29H28FN2Pb
and a molecular weight of 630.76 g/mol.
Molecular Properties
| Compound Name | CID 156879113 |
| PubChem CID | 156879113 |
| Molecular Formula | C29H28FN2Pb |
| Molecular Weight | 630.76 g/mol |
| Exact Mass | 631.20 |
| IUPAC Name | — |
| SMILES | C=C(C)c1ccc(-c2c(C3(C)CNC3)n(-c3ccc(F)cc3)c3cccc(CC[Pb])c23)cc1 |
| InChI | InChI=1S/C29H28FN2.Pb/c1-5-20-7-6-8-25-26(20)27(22-11-9-21(10-12-22)19(2)3)28(29(4)17-31-18-29)32(25)24-15-13-23(30)14-16-24;/h6-16,31H,1-2,5,17-18H2,3-4H3; |
| InChIKey | LTCONBJRLOQFIM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 630.76 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 156879113 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156879113?
The IUPAC name of CID 156879113 (CID 156879113) is not available.
What is the SMILES notation for CID 156879113?
The canonical SMILES for CID 156879113 is C=C(C)c1ccc(-c2c(C3(C)CNC3)n(-c3ccc(F)cc3)c3cccc(CC[Pb])c23)cc1.
What is the InChIKey of CID 156879113?
The InChIKey is LTCONBJRLOQFIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H28FN2.Pb/c1-5-20-7-6-8-25-26(20)27(22-11-9-21(10-12-22)19(2)3)28(29(4)17-31-18-29)32(25)24-15-13-23(30)14-16-24;/h6-16,31H,1-2,5,17-18H2,3-4H3;.
What are the key properties of CID 156879113?
CID 156879113 has a molecular weight of 630.76 g/mol, XLogP of 6.46, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156879113 is sourced from PubChem (CID 156879113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).