About 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline
8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline (PubChem CID 156879672) has the molecular formula C26H25ClFN3O2
and a molecular weight of 465.96 g/mol. Its IUPAC name is 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline.
Molecular Properties
| Compound Name | 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline |
| PubChem CID | 156879672 |
| Molecular Formula | C26H25ClFN3O2 |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline |
| SMILES | Fc1ccc(-c2c(C3CCOCC3)nc(Cl)c3cc4c(cnn4C4CCCCO4)cc23)cc1 |
| InChI | InChI=1S/C26H25ClFN3O2/c27-26-21-14-22-18(15-29-31(22)23-3-1-2-10-33-23)13-20(21)24(16-4-6-19(28)7-5-16)25(30-26)17-8-11-32-12-9-17/h4-7,13-15,17,23H,1-3,8-12H2 |
| InChIKey | DNIISVVGPHHMLU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline?
The IUPAC name of 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline (CID 156879672) is 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline.
What is the SMILES notation for 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline?
The canonical SMILES for 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline is Fc1ccc(-c2c(C3CCOCC3)nc(Cl)c3cc4c(cnn4C4CCCCO4)cc23)cc1.
What is the InChIKey of 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline?
The InChIKey is DNIISVVGPHHMLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25ClFN3O2/c27-26-21-14-22-18(15-29-31(22)23-3-1-2-10-33-23)13-20(21)24(16-4-6-19(28)7-5-16)25(30-26)17-8-11-32-12-9-17/h4-7,13-15,17,23H,1-3,8-12H2.
What are the key properties of 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline?
8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline has a molecular weight of 465.96 g/mol, XLogP of 6.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline is sourced from PubChem (CID 156879672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).