About 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline
7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline (PubChem CID 156879821) has the molecular formula C20H16ClF2N3
and a molecular weight of 371.82 g/mol. Its IUPAC name is 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline.
Molecular Properties
| Compound Name | 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline |
| PubChem CID | 156879821 |
| Molecular Formula | C20H16ClF2N3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline |
| SMILES | Cc1c2nc(Cl)c(C(C)C)c(-c3ccc(F)c(F)c3)c2cc2cn[nH]c12 |
| InChI | InChI=1S/C20H16ClF2N3/c1-9(2)16-17(11-4-5-14(22)15(23)7-11)13-6-12-8-24-26-18(12)10(3)19(13)25-20(16)21/h4-9H,1-3H3,(H,24,26) |
| InChIKey | PVHKQINCRUTVSK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline?
The IUPAC name of 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline (CID 156879821) is 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline.
What is the SMILES notation for 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline?
The canonical SMILES for 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline is Cc1c2nc(Cl)c(C(C)C)c(-c3ccc(F)c(F)c3)c2cc2cn[nH]c12.
What is the InChIKey of 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline?
The InChIKey is PVHKQINCRUTVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClF2N3/c1-9(2)16-17(11-4-5-14(22)15(23)7-11)13-6-12-8-24-26-18(12)10(3)19(13)25-20(16)21/h4-9H,1-3H3,(H,24,26).
What are the key properties of 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline?
7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline has a molecular weight of 371.82 g/mol, XLogP of 6.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-(3,4-difluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline is sourced from PubChem (CID 156879821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).