C21H23FN2O4 — CID 156880459
2-amino-4-(4-fluorophenyl)-3-propan-2-ylquinolin-7-ol;3-hydroxypropanoic acid (PubChem CID 156880459) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-amino-4-(4-fluorophenyl)-3-propan-2-ylquinolin-7-ol;3-hydroxypropanoic acid.
| Compound Name | 2-amino-4-(4-fluorophenyl)-3-propan-2-ylquinolin-7-ol;3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 156880459 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-amino-4-(4-fluorophenyl)-3-propan-2-ylquinolin-7-ol;3-hydroxypropanoic acid |
| SMILES | CC(C)c1c(N)nc2cc(O)ccc2c1-c1ccc(F)cc1.O=C(O)CCO |
| InChI | InChI=1S/C18H17FN2O.C3H6O3/c1-10(2)16-17(11-3-5-12(19)6-4-11)14-8-7-13(22)9-15(14)21-18(16)20;4-2-1-3(5)6/h3-10,22H,1-2H3,(H2,20,21);4H,1-2H2,(H,5,6) |
| InChIKey | BTIWSOZVYFUSLI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |