C14H19N3O2S — CID 156880706
5-(2-cyanopropan-2-yl)-3-ethylsulfanyl-N-methoxy-N-methylpyridine-2-carboxamide (PubChem CID 156880706) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 5-(2-cyanopropan-2-yl)-3-ethylsulfanyl-N-methoxy-N-methylpyridine-2-carboxamide.
| Compound Name | 5-(2-cyanopropan-2-yl)-3-ethylsulfanyl-N-methoxy-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 156880706 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 5-(2-cyanopropan-2-yl)-3-ethylsulfanyl-N-methoxy-N-methylpyridine-2-carboxamide |
| SMILES | CCSc1cc(C(C)(C)C#N)cnc1C(=O)N(C)OC |
| InChI | InChI=1S/C14H19N3O2S/c1-6-20-11-7-10(14(2,3)9-15)8-16-12(11)13(18)17(4)19-5/h7-8H,6H2,1-5H3 |
| InChIKey | KDEKFNBCBSQLCJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|