About 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid
2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid (PubChem CID 156880745) has the molecular formula C11H13F3N2O3S
and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid.
Molecular Properties
| Compound Name | 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid |
| PubChem CID | 156880745 |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid |
| SMILES | CC(C)c1ncc(/C=N/OCC(F)(F)F)cc1S(=O)O |
| InChI | InChI=1S/C11H13F3N2O3S/c1-7(2)10-9(20(17)18)3-8(4-15-10)5-16-19-6-11(12,13)14/h3-5,7H,6H2,1-2H3,(H,17,18)/b16-5+ |
| InChIKey | CCJIKVZLUWVSKU-FZSIALSZSA-N |
| XLogP | 2.70 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid?
The IUPAC name of 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid (CID 156880745) is 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid.
What is the SMILES notation for 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid?
The canonical SMILES for 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid is CC(C)c1ncc(/C=N/OCC(F)(F)F)cc1S(=O)O.
What is the InChIKey of 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid?
The InChIKey is CCJIKVZLUWVSKU-FZSIALSZSA-N. The full InChI is InChI=1S/C11H13F3N2O3S/c1-7(2)10-9(20(17)18)3-8(4-15-10)5-16-19-6-11(12,13)14/h3-5,7H,6H2,1-2H3,(H,17,18)/b16-5+.
What are the key properties of 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid?
2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid has a molecular weight of 310.30 g/mol, XLogP of 2.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-5-[(E)-2,2,2-trifluoroethoxyiminomethyl]pyridine-3-sulfinic acid is sourced from PubChem (CID 156880745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).