About (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane
(E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane (PubChem CID 156880771) has the molecular formula C14H20F3NO3S2
and a molecular weight of 371.45 g/mol. Its IUPAC name is (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane.
Molecular Properties
| Compound Name | (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane |
| PubChem CID | 156880771 |
| Molecular Formula | C14H20F3NO3S2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane |
| SMILES | CCS(=O)(=O)c1cc(/C=N/OCC(F)(F)F)ccc1C(C)C.S |
| InChI | InChI=1S/C14H18F3NO3S.H2S/c1-4-22(19,20)13-7-11(5-6-12(13)10(2)3)8-18-21-9-14(15,16)17;/h5-8,10H,4,9H2,1-3H3;1H2/b18-8+; |
| InChIKey | LYLHTLFCCZUUQY-JUIXXEQESA-N |
| XLogP | 3.63 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane?
The IUPAC name of (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane (CID 156880771) is (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane.
What is the SMILES notation for (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane?
The canonical SMILES for (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane is CCS(=O)(=O)c1cc(/C=N/OCC(F)(F)F)ccc1C(C)C.S.
What is the InChIKey of (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane?
The InChIKey is LYLHTLFCCZUUQY-JUIXXEQESA-N. The full InChI is InChI=1S/C14H18F3NO3S.H2S/c1-4-22(19,20)13-7-11(5-6-12(13)10(2)3)8-18-21-9-14(15,16)17;/h5-8,10H,4,9H2,1-3H3;1H2/b18-8+;.
What are the key properties of (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane?
(E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane has a molecular weight of 371.45 g/mol, XLogP of 3.63, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(3-ethylsulfonyl-4-propan-2-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanimine;sulfane is sourced from PubChem (CID 156880771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).