C16H13ClF3N3O4 — CID 156880835
6-chloro-4-[[2-methoxy-4-(trifluoromethoxy)benzoyl]amino]-N-methylpyridine-3-carboxamide (PubChem CID 156880835) has the molecular formula C16H13ClF3N3O4 and a molecular weight of 403.74 g/mol. Its IUPAC name is 6-chloro-4-[[2-methoxy-4-(trifluoromethoxy)benzoyl]amino]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[[2-methoxy-4-(trifluoromethoxy)benzoyl]amino]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 156880835 |
| Molecular Formula | C16H13ClF3N3O4 |
| Molecular Weight | 403.74 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 6-chloro-4-[[2-methoxy-4-(trifluoromethoxy)benzoyl]amino]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cnc(Cl)cc1NC(=O)c1ccc(OC(F)(F)F)cc1OC |
| InChI | InChI=1S/C16H13ClF3N3O4/c1-21-14(24)10-7-22-13(17)6-11(10)23-15(25)9-4-3-8(5-12(9)26-2)27-16(18,19)20/h3-7H,1-2H3,(H,21,24)(H,22,23,25) |
| InChIKey | HBLZAMRGNMWUNA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|