C21H20N2O — CID 156881420
N-[1-[(3-cyclopropylphenyl)methyl]indol-5-yl]prop-2-enamide (PubChem CID 156881420) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[1-[(3-cyclopropylphenyl)methyl]indol-5-yl]prop-2-enamide.
| Compound Name | N-[1-[(3-cyclopropylphenyl)methyl]indol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 156881420 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-[1-[(3-cyclopropylphenyl)methyl]indol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(ccn2Cc2cccc(C3CC3)c2)c1 |
| InChI | InChI=1S/C21H20N2O/c1-2-21(24)22-19-8-9-20-18(13-19)10-11-23(20)14-15-4-3-5-17(12-15)16-6-7-16/h2-5,8-13,16H,1,6-7,14H2,(H,22,24) |
| InChIKey | UONBRLLCNPKHFP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|