C36H20BN2Pb3 — CID 156881672
CID 156881672 (PubChem CID 156881672) has the molecular formula C36H20BN2Pb3 and a molecular weight of 1112.98 g/mol.
| Compound Name | CID 156881672 |
|---|---|
| PubChem CID | 156881672 |
| Molecular Formula | C36H20BN2Pb3 |
| Molecular Weight | 1112.98 g/mol |
| Exact Mass | 1115.10 |
| IUPAC Name | — |
| SMILES | [Pb]c1cc([Pb])c2c(c1)c1cc(-c3ccccc3)cc([Pb])c1n2B1c2ccccc2-n2c3ccccc3c3cccc1c32 |
| InChI | InChI=1S/C36H20BN2.3Pb/c1-2-11-24(12-3-1)25-21-22-34-29(23-25)27-14-5-8-19-33(27)39(34)37-30-16-6-9-20-35(30)38-32-18-7-4-13-26(32)28-15-10-17-31(37)36(28)38;;;/h1-4,6-18,20-21,23H;;; |
| InChIKey | LFFHEFNLYKKHHY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1112.98 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|