C30H41N5O7 — CID 156882224
[(3S)-3-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] (2S)-1-methylpyrrolidine-2-carboxylate (PubChem CID 156882224) has the molecular formula C30H41N5O7 and a molecular weight of 583.69 g/mol. Its IUPAC name is [(3S)-3-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] (2S)-1-methylpyrrolidine-2-carboxylate.
| Compound Name | [(3S)-3-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] (2S)-1-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 156882224 |
| Molecular Formula | C30H41N5O7 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | [(3S)-3-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] (2S)-1-methylpyrrolidine-2-carboxylate |
| SMILES | COc1cccc2[nH]c(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C[C@@H]3CCNC3=O)C(=O)COC(=O)[C@@H]3CCCN3C)cc12 |
| InChI | InChI=1S/C30H41N5O7/c1-17(2)13-22(34-29(39)23-15-19-20(32-23)7-5-9-26(19)41-4)28(38)33-21(14-18-10-11-31-27(18)37)25(36)16-42-30(40)24-8-6-12-35(24)3/h5,7,9,15,17-18,21-22,24,32H,6,8,10-14,16H2,1-4H3,(H,31,37)(H,33,38)(H,34,39)/t18-,21-,22-,24-/m0/s1 |
| InChIKey | NSJHAPYQRBAZBI-CKLTXHEASA-N |
| XLogP | 1.54 |
| TPSA | 158.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |