C22H29N5O3 — CID 156883047
N'-[(E)-[4-cyclopentyl-5-ethyl-3-(4-formyl-2-methoxyphenyl)imino-1-methyl-6-oxopiperazin-2-ylidene]methyl]methanimidamide (PubChem CID 156883047) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is N'-[(E)-[4-cyclopentyl-5-ethyl-3-(4-formyl-2-methoxyphenyl)imino-1-methyl-6-oxopiperazin-2-ylidene]methyl]methanimidamide.
| Compound Name | N'-[(E)-[4-cyclopentyl-5-ethyl-3-(4-formyl-2-methoxyphenyl)imino-1-methyl-6-oxopiperazin-2-ylidene]methyl]methanimidamide |
|---|---|
| PubChem CID | 156883047 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N'-[(E)-[4-cyclopentyl-5-ethyl-3-(4-formyl-2-methoxyphenyl)imino-1-methyl-6-oxopiperazin-2-ylidene]methyl]methanimidamide |
| SMILES | CCC1C(=O)N(C)C(=C/N=C\N)/C(=N/c2ccc(C=O)cc2OC)N1C1CCCC1 |
| InChI | InChI=1S/C22H29N5O3/c1-4-18-22(29)26(2)19(12-24-14-23)21(27(18)16-7-5-6-8-16)25-17-10-9-15(13-28)11-20(17)30-3/h9-14,16,18H,4-8H2,1-3H3,(H2,23,24)/b19-12+,25-21- |
| InChIKey | XXLNIHIJQUPLEZ-QMBPPXPRSA-N |
| XLogP | 2.86 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|