C32H40ClN3O6 — CID 156884137
methyl (2S)-2-[[(2S)-2-[[2-(3-chlorophenyl)-1-phenylethoxy]carbonylamino]-3-cyclohexylpropanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate (PubChem CID 156884137) has the molecular formula C32H40ClN3O6 and a molecular weight of 598.14 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[2-(3-chlorophenyl)-1-phenylethoxy]carbonylamino]-3-cyclohexylpropanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[2-(3-chlorophenyl)-1-phenylethoxy]carbonylamino]-3-cyclohexylpropanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 156884137 |
| Molecular Formula | C32H40ClN3O6 |
| Molecular Weight | 598.14 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[2-(3-chlorophenyl)-1-phenylethoxy]carbonylamino]-3-cyclohexylpropanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate |
| SMILES | COC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC1CCCCC1)NC(=O)OC(Cc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C32H40ClN3O6/c1-41-31(39)27(20-24-15-16-34-29(24)37)35-30(38)26(18-21-9-4-2-5-10-21)36-32(40)42-28(23-12-6-3-7-13-23)19-22-11-8-14-25(33)17-22/h3,6-8,11-14,17,21,24,26-28H,2,4-5,9-10,15-16,18-20H2,1H3,(H,34,37)(H,35,38)(H,36,40)/t24-,26-,27-,28?/m0/s1 |
| InChIKey | QVQPNGNGLUTTSD-MBWBMJHASA-N |
| XLogP | 4.87 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.14 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |