C15H22ClNO4S — CID 156884506
3-[(3-chlorophenyl)methoxycarbonylamino]-3-sulfanylpropanoic acid;2-methylpropane (PubChem CID 156884506) has the molecular formula C15H22ClNO4S and a molecular weight of 347.86 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methoxycarbonylamino]-3-sulfanylpropanoic acid;2-methylpropane.
| Compound Name | 3-[(3-chlorophenyl)methoxycarbonylamino]-3-sulfanylpropanoic acid;2-methylpropane |
|---|---|
| PubChem CID | 156884506 |
| Molecular Formula | C15H22ClNO4S |
| Molecular Weight | 347.86 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-[(3-chlorophenyl)methoxycarbonylamino]-3-sulfanylpropanoic acid;2-methylpropane |
| SMILES | CC(C)C.O=C(O)CC(S)NC(=O)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H12ClNO4S.C4H10/c12-8-3-1-2-7(4-8)6-17-11(16)13-9(18)5-10(14)15;1-4(2)3/h1-4,9,18H,5-6H2,(H,13,16)(H,14,15);4H,1-3H3 |
| InChIKey | QHYBYXHTJIOMMA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|