C26H38N3O9S- — CID 156884640
(2S)-1-hydroxy-2-[[(2S)-2-[[1-[(3-hydroxyphenyl)methyl]cyclopentyl]oxycarbonylamino]-4-methylpentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonate (PubChem CID 156884640) has the molecular formula C26H38N3O9S- and a molecular weight of 568.67 g/mol. Its IUPAC name is (2S)-1-hydroxy-2-[[(2S)-2-[[1-[(3-hydroxyphenyl)methyl]cyclopentyl]oxycarbonylamino]-4-methylpentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonate.
| Compound Name | (2S)-1-hydroxy-2-[[(2S)-2-[[1-[(3-hydroxyphenyl)methyl]cyclopentyl]oxycarbonylamino]-4-methylpentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 156884640 |
| Molecular Formula | C26H38N3O9S- |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | (2S)-1-hydroxy-2-[[(2S)-2-[[1-[(3-hydroxyphenyl)methyl]cyclopentyl]oxycarbonylamino]-4-methylpentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonate |
| SMILES | CC(C)C[C@H](NC(=O)OC1(Cc2cccc(O)c2)CCCC1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(O)S(=O)(=O)[O-] |
| InChI | InChI=1S/C26H39N3O9S/c1-16(2)12-20(23(32)28-21(24(33)39(35,36)37)14-18-8-11-27-22(18)31)29-25(34)38-26(9-3-4-10-26)15-17-6-5-7-19(30)13-17/h5-7,13,16,18,20-21,24,30,33H,3-4,8-12,14-15H2,1-2H3,(H,27,31)(H,28,32)(H,29,34)(H,35,36,37)/p-1/t18-,20-,21-,24?/m0/s1 |
| InChIKey | QNYXYBGURMTIGB-FTLHBZISSA-M |
| XLogP | 1.26 |
| TPSA | 194.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|