C17H16FNO — CID 156884707
2-(5-fluoro-2-phenylmethoxyphenyl)-2,5-dihydro-1H-pyrrole (PubChem CID 156884707) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-(5-fluoro-2-phenylmethoxyphenyl)-2,5-dihydro-1H-pyrrole.
| Compound Name | 2-(5-fluoro-2-phenylmethoxyphenyl)-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 156884707 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(5-fluoro-2-phenylmethoxyphenyl)-2,5-dihydro-1H-pyrrole |
| SMILES | Fc1ccc(OCc2ccccc2)c(C2C=CCN2)c1 |
| InChI | InChI=1S/C17H16FNO/c18-14-8-9-17(15(11-14)16-7-4-10-19-16)20-12-13-5-2-1-3-6-13/h1-9,11,16,19H,10,12H2 |
| InChIKey | ZBCGKXGLWBHWAS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|