C12H7N3S — CID 15688476
3-amino-5-phenylthiophene-2,4-dicarbonitrile (PubChem CID 15688476) has the molecular formula C12H7N3S and a molecular weight of 225.28 g/mol. Its IUPAC name is 3-amino-5-phenylthiophene-2,4-dicarbonitrile.
| Compound Name | 3-amino-5-phenylthiophene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 15688476 |
| Molecular Formula | C12H7N3S |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 3-amino-5-phenylthiophene-2,4-dicarbonitrile |
| SMILES | N#Cc1sc(-c2ccccc2)c(C#N)c1N |
| InChI | InChI=1S/C12H7N3S/c13-6-9-11(15)10(7-14)16-12(9)8-4-2-1-3-5-8/h1-5H,15H2 |
| InChIKey | XMGZBJJFBKPCHR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |