About (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate
(7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate (PubChem CID 156885244) has the molecular formula C10H9BF3N3O3S2
and a molecular weight of 351.14 g/mol. Its IUPAC name is (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate |
| PubChem CID | 156885244 |
| Molecular Formula | C10H9BF3N3O3S2 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCB(C#N)C2 |
| InChI | InChI=1S/C10H9BF3N3O3S2/c1-21-9-16-7-4-11(5-15)3-2-6(7)8(17-9)20-22(18,19)10(12,13)14/h2-4H2,1H3 |
| InChIKey | UDPHTXLMTOZRPZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate?
The IUPAC name of (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate (CID 156885244) is (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate?
The canonical SMILES for (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate is CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCB(C#N)C2.
What is the InChIKey of (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate?
The InChIKey is UDPHTXLMTOZRPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BF3N3O3S2/c1-21-9-16-7-4-11(5-15)3-2-6(7)8(17-9)20-22(18,19)10(12,13)14/h2-4H2,1H3.
What are the key properties of (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate?
(7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate has a molecular weight of 351.14 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (7-cyano-2-methylsulfanyl-6,8-dihydro-5H-borinino[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 156885244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).