C23H32N2O6 — CID 156886615
5-(2,3-diacetylanilino)pentanoic acid;3-propan-2-ylpiperidine-2,6-dione (PubChem CID 156886615) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is 5-(2,3-diacetylanilino)pentanoic acid;3-propan-2-ylpiperidine-2,6-dione.
| Compound Name | 5-(2,3-diacetylanilino)pentanoic acid;3-propan-2-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 156886615 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 5-(2,3-diacetylanilino)pentanoic acid;3-propan-2-ylpiperidine-2,6-dione |
| SMILES | CC(=O)c1cccc(NCCCCC(=O)O)c1C(C)=O.CC(C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H19NO4.C8H13NO2/c1-10(17)12-6-5-7-13(15(12)11(2)18)16-9-4-3-8-14(19)20;1-5(2)6-3-4-7(10)9-8(6)11/h5-7,16H,3-4,8-9H2,1-2H3,(H,19,20);5-6H,3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | POCOASSQBFRGLY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|