C13H22N2O — CID 156886740
(2E,5E,6Z)-5-ethylidene-4-imino-3-propoxyocta-2,6-dien-2-amine (PubChem CID 156886740) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (2E,5E,6Z)-5-ethylidene-4-imino-3-propoxyocta-2,6-dien-2-amine.
| Compound Name | (2E,5E,6Z)-5-ethylidene-4-imino-3-propoxyocta-2,6-dien-2-amine |
|---|---|
| PubChem CID | 156886740 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (2E,5E,6Z)-5-ethylidene-4-imino-3-propoxyocta-2,6-dien-2-amine |
| SMILES | [H]/N=C(C(\C=C/C)=C\C)/C(OCCC)=C(/C)N |
| InChI | InChI=1S/C13H22N2O/c1-5-8-11(7-3)12(15)13(10(4)14)16-9-6-2/h5,7-8,15H,6,9,14H2,1-4H3/b8-5-,11-7+,13-10+,15-12+ |
| InChIKey | GDRVQQQZBDVYHH-MRXLDZDSSA-N |
| XLogP | 3.15 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|