C11H14N4O2 — CID 156887174
[4-(1-methoxyethyl)pyrrolo[1,2-b]pyridazin-3-yl]urea (PubChem CID 156887174) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is [4-(1-methoxyethyl)pyrrolo[1,2-b]pyridazin-3-yl]urea.
| Compound Name | [4-(1-methoxyethyl)pyrrolo[1,2-b]pyridazin-3-yl]urea |
|---|---|
| PubChem CID | 156887174 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | [4-(1-methoxyethyl)pyrrolo[1,2-b]pyridazin-3-yl]urea |
| SMILES | COC(C)c1c(NC(N)=O)cnn2cccc12 |
| InChI | InChI=1S/C11H14N4O2/c1-7(17-2)10-8(14-11(12)16)6-13-15-5-3-4-9(10)15/h3-7H,1-2H3,(H3,12,14,16) |
| InChIKey | YPHSPBYAPNUZEY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |