C24H25N9O — CID 156887410
6-[3-hydroxy-4-[3-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-1,2,4-triazin-6-yl]phenyl]-2-methylimidazo[1,2-b]pyridazine-8-carbonitrile (PubChem CID 156887410) has the molecular formula C24H25N9O and a molecular weight of 455.53 g/mol. Its IUPAC name is 6-[3-hydroxy-4-[3-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-1,2,4-triazin-6-yl]phenyl]-2-methylimidazo[1,2-b]pyridazine-8-carbonitrile.
| Compound Name | 6-[3-hydroxy-4-[3-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-1,2,4-triazin-6-yl]phenyl]-2-methylimidazo[1,2-b]pyridazine-8-carbonitrile |
|---|---|
| PubChem CID | 156887410 |
| Molecular Formula | C24H25N9O |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 6-[3-hydroxy-4-[3-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-1,2,4-triazin-6-yl]phenyl]-2-methylimidazo[1,2-b]pyridazine-8-carbonitrile |
| SMILES | Cc1cn2nc(-c3ccc(-c4cnc(N5C[C@@H](C)N(C)[C@@H](C)C5)nn4)c(O)c3)cc(C#N)c2n1 |
| InChI | InChI=1S/C24H25N9O/c1-14-11-33-23(27-14)18(9-25)7-20(30-33)17-5-6-19(22(34)8-17)21-10-26-24(29-28-21)32-12-15(2)31(4)16(3)13-32/h5-8,10-11,15-16,34H,12-13H2,1-4H3/t15-,16+ |
| InChIKey | OYCLVMPKUCJNMN-IYBDPMFKSA-N |
| XLogP | 2.66 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |