C24H28N6O2S — CID 156888120
4-[2-(2,7-dimethylindazol-5-yl)-7-oxo-[1,3]thiazolo[5,4-d]pyrimidin-6-yl]-2,2,6,6-tetramethylpiperidine-1-carbaldehyde (PubChem CID 156888120) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is 4-[2-(2,7-dimethylindazol-5-yl)-7-oxo-[1,3]thiazolo[5,4-d]pyrimidin-6-yl]-2,2,6,6-tetramethylpiperidine-1-carbaldehyde.
| Compound Name | 4-[2-(2,7-dimethylindazol-5-yl)-7-oxo-[1,3]thiazolo[5,4-d]pyrimidin-6-yl]-2,2,6,6-tetramethylpiperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 156888120 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 4-[2-(2,7-dimethylindazol-5-yl)-7-oxo-[1,3]thiazolo[5,4-d]pyrimidin-6-yl]-2,2,6,6-tetramethylpiperidine-1-carbaldehyde |
| SMILES | Cc1cc(-c2nc3c(=O)n(C4CC(C)(C)N(C=O)C(C)(C)C4)cnc3s2)cc2cn(C)nc12 |
| InChI | InChI=1S/C24H28N6O2S/c1-14-7-15(8-16-11-28(6)27-18(14)16)20-26-19-21(33-20)25-12-29(22(19)32)17-9-23(2,3)30(13-31)24(4,5)10-17/h7-8,11-13,17H,9-10H2,1-6H3 |
| InChIKey | VCXFUIMRUXNJOJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|