About (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine
(4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine (PubChem CID 156888210) has the molecular formula C9H12FN3
and a molecular weight of 181.21 g/mol. Its IUPAC name is (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine |
| PubChem CID | 156888210 |
| Molecular Formula | C9H12FN3 |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine |
| SMILES | C=NN(C)/C=C1/C=CC(N)=C(F)C1 |
| InChI | InChI=1S/C9H12FN3/c1-12-13(2)6-7-3-4-9(11)8(10)5-7/h3-4,6H,1,5,11H2,2H3/b7-6- |
| InChIKey | ULVYNGVUZAJQAO-SREVYHEPSA-N |
| XLogP | 1.52 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine?
The IUPAC name of (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine (CID 156888210) is (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine?
The canonical SMILES for (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine is C=NN(C)/C=C1/C=CC(N)=C(F)C1.
What is the InChIKey of (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine?
The InChIKey is ULVYNGVUZAJQAO-SREVYHEPSA-N. The full InChI is InChI=1S/C9H12FN3/c1-12-13(2)6-7-3-4-9(11)8(10)5-7/h3-4,6H,1,5,11H2,2H3/b7-6-.
What are the key properties of (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine?
(4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine has a molecular weight of 181.21 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-2-fluoro-4-[[methyl-(methylideneamino)amino]methylidene]cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 156888210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).