C20H19FN6O — CID 156888276
3-(7-fluoro-2-methylindazol-5-yl)-6-piperazin-1-ylquinazolin-4-one (PubChem CID 156888276) has the molecular formula C20H19FN6O and a molecular weight of 378.41 g/mol. Its IUPAC name is 3-(7-fluoro-2-methylindazol-5-yl)-6-piperazin-1-ylquinazolin-4-one.
| Compound Name | 3-(7-fluoro-2-methylindazol-5-yl)-6-piperazin-1-ylquinazolin-4-one |
|---|---|
| PubChem CID | 156888276 |
| Molecular Formula | C20H19FN6O |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3-(7-fluoro-2-methylindazol-5-yl)-6-piperazin-1-ylquinazolin-4-one |
| SMILES | Cn1cc2cc(-n3cnc4ccc(N5CCNCC5)cc4c3=O)cc(F)c2n1 |
| InChI | InChI=1S/C20H19FN6O/c1-25-11-13-8-15(10-17(21)19(13)24-25)27-12-23-18-3-2-14(9-16(18)20(27)28)26-6-4-22-5-7-26/h2-3,8-12,22H,4-7H2,1H3 |
| InChIKey | HPRDZFUJDGWWFS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |