C25H28FN3O2 — CID 156888432
tert-butyl 5-(1-cyano-3-fluorospiro[5,7,8,9-tetrahydrocarbazole-6,1'-cyclopropane]-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 156888432) has the molecular formula C25H28FN3O2 and a molecular weight of 421.52 g/mol. Its IUPAC name is tert-butyl 5-(1-cyano-3-fluorospiro[5,7,8,9-tetrahydrocarbazole-6,1'-cyclopropane]-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-(1-cyano-3-fluorospiro[5,7,8,9-tetrahydrocarbazole-6,1'-cyclopropane]-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 156888432 |
| Molecular Formula | C25H28FN3O2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | tert-butyl 5-(1-cyano-3-fluorospiro[5,7,8,9-tetrahydrocarbazole-6,1'-cyclopropane]-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC=C(c2c(F)cc(C#N)c3[nH]c4c(c23)CC2(CC4)CC2)C1 |
| InChI | InChI=1S/C25H28FN3O2/c1-24(2,3)31-23(30)29-10-4-5-15(14-29)20-18(26)11-16(13-27)22-21(20)17-12-25(8-9-25)7-6-19(17)28-22/h5,11,28H,4,6-10,12,14H2,1-3H3 |
| InChIKey | GRFBBIIKAHTROB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |