C23H25N3O2 — CID 156888459
4-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-5-yl)spiro[5,7,8,9-tetrahydrocarbazole-6,1'-cyclopropane]-1-carboxamide (PubChem CID 156888459) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-5-yl)spiro[5,7,8,9-tetrahydrocarbazole-6,1'-cyclopropane]-1-carboxamide.
| Compound Name | 4-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-5-yl)spiro[5,7,8,9-tetrahydrocarbazole-6,1'-cyclopropane]-1-carboxamide |
|---|---|
| PubChem CID | 156888459 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 4-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-5-yl)spiro[5,7,8,9-tetrahydrocarbazole-6,1'-cyclopropane]-1-carboxamide |
| SMILES | C=CC(=O)N1CCC=C(c2ccc(C(N)=O)c3[nH]c4c(c23)CC2(CC4)CC2)C1 |
| InChI | InChI=1S/C23H25N3O2/c1-2-19(27)26-11-3-4-14(13-26)15-5-6-16(22(24)28)21-20(15)17-12-23(9-10-23)8-7-18(17)25-21/h2,4-6,25H,1,3,7-13H2,(H2,24,28) |
| InChIKey | IHOUNOCMMWOFLA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|