C24H31N7OS — CID 156888815
7-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 156888815) has the molecular formula C24H31N7OS and a molecular weight of 465.63 g/mol. Its IUPAC name is 7-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 156888815 |
| Molecular Formula | C24H31N7OS |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 7-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1cn2nc(-c3cc(=O)n4cc(N(C)C5CC(C)(C)NC(C)(C)C5)sc4n3)cc(C)c2n1 |
| InChI | InChI=1S/C24H31N7OS/c1-14-8-18(27-31-12-15(2)25-21(14)31)17-9-19(32)30-13-20(33-22(30)26-17)29(7)16-10-23(3,4)28-24(5,6)11-16/h8-9,12-13,16,28H,10-11H2,1-7H3 |
| InChIKey | YVJFSNHKYLHHBW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |